C11H13NO5 — CID 141025057
(2,4-dihydroxy-1-oxo-3-phenylbutan-2-yl) carbamate (PubChem CID 141025057) has the molecular formula C11H13NO5 and a molecular weight of 239.23 g/mol. Its IUPAC name is (2,4-dihydroxy-1-oxo-3-phenylbutan-2-yl) carbamate.
| Compound Name | (2,4-dihydroxy-1-oxo-3-phenylbutan-2-yl) carbamate |
|---|---|
| PubChem CID | 141025057 |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | (2,4-dihydroxy-1-oxo-3-phenylbutan-2-yl) carbamate |
| SMILES | NC(=O)OC(O)(C=O)C(CO)c1ccccc1 |
| InChI | InChI=1S/C11H13NO5/c12-10(15)17-11(16,7-14)9(6-13)8-4-2-1-3-5-8/h1-5,7,9,13,16H,6H2,(H2,12,15) |
| InChIKey | SZXGJOQVABBVEE-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|