C16H17N5O2 — CID 141025235
3-[3-[(4-methoxyphenyl)methyl]-1H-pyrrol-2-yl]-1-(2H-tetrazol-5-yl)prop-2-en-1-ol (PubChem CID 141025235) has the molecular formula C16H17N5O2 and a molecular weight of 311.35 g/mol. Its IUPAC name is 3-[3-[(4-methoxyphenyl)methyl]-1H-pyrrol-2-yl]-1-(2H-tetrazol-5-yl)prop-2-en-1-ol.
| Compound Name | 3-[3-[(4-methoxyphenyl)methyl]-1H-pyrrol-2-yl]-1-(2H-tetrazol-5-yl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 141025235 |
| Molecular Formula | C16H17N5O2 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 3-[3-[(4-methoxyphenyl)methyl]-1H-pyrrol-2-yl]-1-(2H-tetrazol-5-yl)prop-2-en-1-ol |
| SMILES | COc1ccc(Cc2cc[nH]c2C=CC(O)c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C16H17N5O2/c1-23-13-4-2-11(3-5-13)10-12-8-9-17-14(12)6-7-15(22)16-18-20-21-19-16/h2-9,15,17,22H,10H2,1H3,(H,18,19,20,21) |
| InChIKey | GWMKPJKRCBBDQK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 99.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |