C20H25NO2S — CID 141026419
methyl (2S)-2-[(2-ethyl-6-methylphenyl)sulfanylmethylamino]-3-phenylpropanoate (PubChem CID 141026419) has the molecular formula C20H25NO2S and a molecular weight of 343.49 g/mol. Its IUPAC name is methyl (2S)-2-[(2-ethyl-6-methylphenyl)sulfanylmethylamino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[(2-ethyl-6-methylphenyl)sulfanylmethylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 141026419 |
| Molecular Formula | C20H25NO2S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | methyl (2S)-2-[(2-ethyl-6-methylphenyl)sulfanylmethylamino]-3-phenylpropanoate |
| SMILES | CCc1cccc(C)c1SCN[C@@H](Cc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C20H25NO2S/c1-4-17-12-8-9-15(2)19(17)24-14-21-18(20(22)23-3)13-16-10-6-5-7-11-16/h5-12,18,21H,4,13-14H2,1-3H3/t18-/m0/s1 |
| InChIKey | UASHFSIQKWWVJQ-SFHVURJKSA-N |
| XLogP | 3.98 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|