C10H11N5 — CID 141026959
5-ethyl-4,5,7,11,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,7,9-pentaene (PubChem CID 141026959) has the molecular formula C10H11N5 and a molecular weight of 201.23 g/mol. Its IUPAC name is 5-ethyl-4,5,7,11,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,7,9-pentaene.
| Compound Name | 5-ethyl-4,5,7,11,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,7,9-pentaene |
|---|---|
| PubChem CID | 141026959 |
| Molecular Formula | C10H11N5 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 5-ethyl-4,5,7,11,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,7,9-pentaene |
| SMILES | CCn1ncc2c3c(cnc21)=CNNC=3 |
| InChI | InChI=1S/C10H11N5/c1-2-15-10-9(6-14-15)8-5-13-12-4-7(8)3-11-10/h3-6,12-13H,2H2,1H3 |
| InChIKey | DSOZDDSFWGTJRM-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |