C9H18N4 — CID 69433978
(1,4-dipropylpyrazol-5-yl)hydrazine (PubChem CID 69433978) has the molecular formula C9H18N4 and a molecular weight of 182.27 g/mol. Its IUPAC name is (1,4-dipropylpyrazol-5-yl)hydrazine.
| Compound Name | (1,4-dipropylpyrazol-5-yl)hydrazine |
|---|---|
| PubChem CID | 69433978 |
| Molecular Formula | C9H18N4 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | (1,4-dipropylpyrazol-5-yl)hydrazine |
| SMILES | CCCc1cnn(CCC)c1NN |
| InChI | InChI=1S/C9H18N4/c1-3-5-8-7-11-13(6-4-2)9(8)12-10/h7,12H,3-6,10H2,1-2H3 |
| InChIKey | LBWCQJNSPTZYBJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|