C9H16F3N5 — CID 105230789
1-methyl-4-(5,5,5-trifluoro-1-hydrazinylpentyl)pyrazol-5-amine (PubChem CID 105230789) has the molecular formula C9H16F3N5 and a molecular weight of 251.26 g/mol. Its IUPAC name is 1-methyl-4-(5,5,5-trifluoro-1-hydrazinylpentyl)pyrazol-5-amine.
| Compound Name | 1-methyl-4-(5,5,5-trifluoro-1-hydrazinylpentyl)pyrazol-5-amine |
|---|---|
| PubChem CID | 105230789 |
| Molecular Formula | C9H16F3N5 |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 1-methyl-4-(5,5,5-trifluoro-1-hydrazinylpentyl)pyrazol-5-amine |
| SMILES | Cn1ncc(C(CCCC(F)(F)F)NN)c1N |
| InChI | InChI=1S/C9H16F3N5/c1-17-8(13)6(5-15-17)7(16-14)3-2-4-9(10,11)12/h5,7,16H,2-4,13-14H2,1H3 |
| InChIKey | XGXTUXHNWUBPTI-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 81.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|