C18H21BrN2O5S — CID 141028536
2-bromo-N-[2-[3-hydroxy-2-[[3-(methanesulfonamido)phenyl]methoxy]phenyl]ethyl]acetamide (PubChem CID 141028536) has the molecular formula C18H21BrN2O5S and a molecular weight of 457.35 g/mol. Its IUPAC name is 2-bromo-N-[2-[3-hydroxy-2-[[3-(methanesulfonamido)phenyl]methoxy]phenyl]ethyl]acetamide.
| Compound Name | 2-bromo-N-[2-[3-hydroxy-2-[[3-(methanesulfonamido)phenyl]methoxy]phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 141028536 |
| Molecular Formula | C18H21BrN2O5S |
| Molecular Weight | 457.35 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | 2-bromo-N-[2-[3-hydroxy-2-[[3-(methanesulfonamido)phenyl]methoxy]phenyl]ethyl]acetamide |
| SMILES | CS(=O)(=O)Nc1cccc(COc2c(O)cccc2CCNC(=O)CBr)c1 |
| InChI | InChI=1S/C18H21BrN2O5S/c1-27(24,25)21-15-6-2-4-13(10-15)12-26-18-14(5-3-7-16(18)22)8-9-20-17(23)11-19/h2-7,10,21-22H,8-9,11-12H2,1H3,(H,20,23) |
| InChIKey | VNBUYHSZMOQECU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|