C11H14BrClN2O4S — CID 70116616
2-bromo-N-[2-[4-chloro-2-hydroxy-3-(methanesulfonamido)phenyl]ethyl]acetamide (PubChem CID 70116616) has the molecular formula C11H14BrClN2O4S and a molecular weight of 385.67 g/mol. Its IUPAC name is 2-bromo-N-[2-[4-chloro-2-hydroxy-3-(methanesulfonamido)phenyl]ethyl]acetamide.
| Compound Name | 2-bromo-N-[2-[4-chloro-2-hydroxy-3-(methanesulfonamido)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 70116616 |
| Molecular Formula | C11H14BrClN2O4S |
| Molecular Weight | 385.67 g/mol |
| Exact Mass | 383.95 |
| IUPAC Name | 2-bromo-N-[2-[4-chloro-2-hydroxy-3-(methanesulfonamido)phenyl]ethyl]acetamide |
| SMILES | CS(=O)(=O)Nc1c(Cl)ccc(CCNC(=O)CBr)c1O |
| InChI | InChI=1S/C11H14BrClN2O4S/c1-20(18,19)15-10-8(13)3-2-7(11(10)17)4-5-14-9(16)6-12/h2-3,15,17H,4-6H2,1H3,(H,14,16) |
| InChIKey | OJRYZOAZPAHPRT-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.67 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|