C15H24N2O4 — CID 145415134
3-acetamido-N-[2-(2,3-dihydroxyphenyl)ethyl]propanamide;ethane (PubChem CID 145415134) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is 3-acetamido-N-[2-(2,3-dihydroxyphenyl)ethyl]propanamide;ethane.
| Compound Name | 3-acetamido-N-[2-(2,3-dihydroxyphenyl)ethyl]propanamide;ethane |
|---|---|
| PubChem CID | 145415134 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 3-acetamido-N-[2-(2,3-dihydroxyphenyl)ethyl]propanamide;ethane |
| SMILES | CC.CC(=O)NCCC(=O)NCCc1cccc(O)c1O |
| InChI | InChI=1S/C13H18N2O4.C2H6/c1-9(16)14-8-6-12(18)15-7-5-10-3-2-4-11(17)13(10)19;1-2/h2-4,17,19H,5-8H2,1H3,(H,14,16)(H,15,18);1-2H3 |
| InChIKey | NWXUKPNDCUCFFI-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|