C9H15BrO — CID 141028799
1-bromotricyclo[3.3.1.02,4]nonane;hydrate (PubChem CID 141028799) has the molecular formula C9H15BrO and a molecular weight of 219.12 g/mol. Its IUPAC name is 1-bromotricyclo[3.3.1.02,4]nonane;hydrate.
| Compound Name | 1-bromotricyclo[3.3.1.02,4]nonane;hydrate |
|---|---|
| PubChem CID | 141028799 |
| Molecular Formula | C9H15BrO |
| Molecular Weight | 219.12 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 1-bromotricyclo[3.3.1.02,4]nonane;hydrate |
| SMILES | BrC12CCCC(C1)C1CC12.O |
| InChI | InChI=1S/C9H13Br.H2O/c10-9-3-1-2-6(5-9)7-4-8(7)9;/h6-8H,1-5H2;1H2 |
| InChIKey | ORNXAULVEGQVBU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.12 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|