C9H14O — CID 12644101
[(1S,2R,4R,5S)-1-tricyclo[3.2.1.02,4]octanyl]methanol (PubChem CID 12644101) has the molecular formula C9H14O and a molecular weight of 138.21 g/mol. Its IUPAC name is [(1S,2R,4R,5S)-1-tricyclo[3.2.1.02,4]octanyl]methanol.
| Compound Name | [(1S,2R,4R,5S)-1-tricyclo[3.2.1.02,4]octanyl]methanol |
|---|---|
| PubChem CID | 12644101 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | [(1S,2R,4R,5S)-1-tricyclo[3.2.1.02,4]octanyl]methanol |
| SMILES | OC[C@@]12CC[C@@H](C1)[C@H]1C[C@H]12 |
| InChI | InChI=1S/C9H14O/c10-5-9-2-1-6(4-9)7-3-8(7)9/h6-8,10H,1-5H2/t6-,7+,8+,9+/m0/s1 |
| InChIKey | BUJGXHMXDJNXMU-JQCXWYLXSA-N |
| XLogP | 1.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |