C18H26O4 — CID 135181106
2-[1-(acetyloxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]ethyl prop-2-enoate (PubChem CID 135181106) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is 2-[1-(acetyloxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]ethyl prop-2-enoate.
| Compound Name | 2-[1-(acetyloxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 135181106 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 2-[1-(acetyloxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCC1CC2C3CCC(COC(C)=O)(C3)C2C1 |
| InChI | InChI=1S/C18H26O4/c1-3-17(20)21-7-5-13-8-15-14-4-6-18(10-14,16(15)9-13)11-22-12(2)19/h3,13-16H,1,4-11H2,2H3 |
| InChIKey | LAHKNSRMBOABHH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|