C12H9FN2OS — CID 141029561
5-(4-fluorophenyl)-2-methylpyrimidine-4-carbothioic S-acid (PubChem CID 141029561) has the molecular formula C12H9FN2OS and a molecular weight of 248.28 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-2-methylpyrimidine-4-carbothioic S-acid.
| Compound Name | 5-(4-fluorophenyl)-2-methylpyrimidine-4-carbothioic S-acid |
|---|---|
| PubChem CID | 141029561 |
| Molecular Formula | C12H9FN2OS |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 5-(4-fluorophenyl)-2-methylpyrimidine-4-carbothioic S-acid |
| SMILES | Cc1ncc(-c2ccc(F)cc2)c(C(=O)S)n1 |
| InChI | InChI=1S/C12H9FN2OS/c1-7-14-6-10(11(15-7)12(16)17)8-2-4-9(13)5-3-8/h2-6H,1H3,(H,16,17) |
| InChIKey | AVELQWKMMYRFRY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|