C20H15N3O6 — CID 141031923
2-[(2-hydroxy-6-azabicyclo[3.1.1]hepta-1,3,5(7)-trien-6-yl)amino]-3-nitro-5-phenylmethoxybenzoic acid (PubChem CID 141031923) has the molecular formula C20H15N3O6 and a molecular weight of 393.36 g/mol. Its IUPAC name is 2-[(2-hydroxy-6-azabicyclo[3.1.1]hepta-1,3,5(7)-trien-6-yl)amino]-3-nitro-5-phenylmethoxybenzoic acid.
| Compound Name | 2-[(2-hydroxy-6-azabicyclo[3.1.1]hepta-1,3,5(7)-trien-6-yl)amino]-3-nitro-5-phenylmethoxybenzoic acid |
|---|---|
| PubChem CID | 141031923 |
| Molecular Formula | C20H15N3O6 |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 2-[(2-hydroxy-6-azabicyclo[3.1.1]hepta-1,3,5(7)-trien-6-yl)amino]-3-nitro-5-phenylmethoxybenzoic acid |
| SMILES | O=C(O)c1cc(OCc2ccccc2)cc([N+](=O)[O-])c1NN1C2=CC1=C(O)C=C2 |
| InChI | InChI=1S/C20H15N3O6/c24-18-7-6-13-8-16(18)22(13)21-19-15(20(25)26)9-14(10-17(19)23(27)28)29-11-12-4-2-1-3-5-12/h1-10,21,24H,11H2,(H,25,26) |
| InChIKey | PYQBCRMDPFBZTA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 125.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|