About tris[(2-naphthalen-2-ylacetyl)oxy]stannyl 2-naphthalen-2-ylacetate
tris[(2-naphthalen-2-ylacetyl)oxy]stannyl 2-naphthalen-2-ylacetate (PubChem CID 141032751) has the molecular formula C48H36O8Sn
and a molecular weight of 859.52 g/mol. Its IUPAC name is tris[(2-naphthalen-2-ylacetyl)oxy]stannyl 2-naphthalen-2-ylacetate.
Molecular Properties
| Compound Name | tris[(2-naphthalen-2-ylacetyl)oxy]stannyl 2-naphthalen-2-ylacetate |
| PubChem CID | 141032751 |
| Molecular Formula | C48H36O8Sn |
| Molecular Weight | 859.52 g/mol |
| Exact Mass | 860.14 |
| IUPAC Name | tris[(2-naphthalen-2-ylacetyl)oxy]stannyl 2-naphthalen-2-ylacetate |
| SMILES | O=C(Cc1ccc2ccccc2c1)O[Sn](OC(=O)Cc1ccc2ccccc2c1)(OC(=O)Cc1ccc2ccccc2c1)OC(=O)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/4C12H10O2.Sn/c4*13-12(14)8-9-5-6-10-3-1-2-4-11(10)7-9;/h4*1-7H,8H2,(H,13,14);/q;;;;+4/p-4 |
| InChIKey | RWFWOWFPZHDXCK-UHFFFAOYSA-J |
| XLogP | 9.18 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 859.52 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze tris[(2-naphthalen-2-ylacetyl)oxy]stannyl 2-naphthalen-2-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris[(2-naphthalen-2-ylacetyl)oxy]stannyl 2-naphthalen-2-ylacetate?
The IUPAC name of tris[(2-naphthalen-2-ylacetyl)oxy]stannyl 2-naphthalen-2-ylacetate (CID 141032751) is tris[(2-naphthalen-2-ylacetyl)oxy]stannyl 2-naphthalen-2-ylacetate.
What is the SMILES notation for tris[(2-naphthalen-2-ylacetyl)oxy]stannyl 2-naphthalen-2-ylacetate?
The canonical SMILES for tris[(2-naphthalen-2-ylacetyl)oxy]stannyl 2-naphthalen-2-ylacetate is O=C(Cc1ccc2ccccc2c1)O[Sn](OC(=O)Cc1ccc2ccccc2c1)(OC(=O)Cc1ccc2ccccc2c1)OC(=O)Cc1ccc2ccccc2c1.
What is the InChIKey of tris[(2-naphthalen-2-ylacetyl)oxy]stannyl 2-naphthalen-2-ylacetate?
The InChIKey is RWFWOWFPZHDXCK-UHFFFAOYSA-J. The full InChI is InChI=1S/4C12H10O2.Sn/c4*13-12(14)8-9-5-6-10-3-1-2-4-11(10)7-9;/h4*1-7H,8H2,(H,13,14);/q;;;;+4/p-4.
What are the key properties of tris[(2-naphthalen-2-ylacetyl)oxy]stannyl 2-naphthalen-2-ylacetate?
tris[(2-naphthalen-2-ylacetyl)oxy]stannyl 2-naphthalen-2-ylacetate has a molecular weight of 859.52 g/mol, XLogP of 9.18, 12 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for tris[(2-naphthalen-2-ylacetyl)oxy]stannyl 2-naphthalen-2-ylacetate is sourced from PubChem (CID 141032751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).