C9H13N5 — CID 141033636
N'-[(E)-2-amino-1,2-dicyanoethenyl]-3-methylbutanimidamide (PubChem CID 141033636) has the molecular formula C9H13N5 and a molecular weight of 191.24 g/mol. Its IUPAC name is N'-[(E)-2-amino-1,2-dicyanoethenyl]-3-methylbutanimidamide.
| Compound Name | N'-[(E)-2-amino-1,2-dicyanoethenyl]-3-methylbutanimidamide |
|---|---|
| PubChem CID | 141033636 |
| Molecular Formula | C9H13N5 |
| Molecular Weight | 191.24 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | N'-[(E)-2-amino-1,2-dicyanoethenyl]-3-methylbutanimidamide |
| SMILES | CC(C)C/C(N)=N\C(C#N)=C(\N)C#N |
| InChI | InChI=1S/C9H13N5/c1-6(2)3-9(13)14-8(5-11)7(12)4-10/h6H,3,12H2,1-2H3,(H2,13,14)/b8-7+ |
| InChIKey | WVIFSTDXMZXEEZ-BQYQJAHWSA-N |
| XLogP | 0.61 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.24 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|