C8H11N5 — CID 85039957
N'-(2-amino-1,2-dicyanoethenyl)butanimidamide (PubChem CID 85039957) has the molecular formula C8H11N5 and a molecular weight of 177.21 g/mol. Its IUPAC name is N'-(2-amino-1,2-dicyanoethenyl)butanimidamide.
| Compound Name | N'-(2-amino-1,2-dicyanoethenyl)butanimidamide |
|---|---|
| PubChem CID | 85039957 |
| Molecular Formula | C8H11N5 |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | N'-(2-amino-1,2-dicyanoethenyl)butanimidamide |
| SMILES | CCC/C(N)=N\C(C#N)=C(N)C#N |
| InChI | InChI=1S/C8H11N5/c1-2-3-8(12)13-7(5-10)6(11)4-9/h2-3,11H2,1H3,(H2,12,13) |
| InChIKey | DPDDQMZYJRIFLI-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|