C17H17NO2 — CID 141034830
4-(2-methoxyethoxy)-3-(2-phenylethynyl)aniline (PubChem CID 141034830) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is 4-(2-methoxyethoxy)-3-(2-phenylethynyl)aniline.
| Compound Name | 4-(2-methoxyethoxy)-3-(2-phenylethynyl)aniline |
|---|---|
| PubChem CID | 141034830 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 4-(2-methoxyethoxy)-3-(2-phenylethynyl)aniline |
| SMILES | COCCOc1ccc(N)cc1C#Cc1ccccc1 |
| InChI | InChI=1S/C17H17NO2/c1-19-11-12-20-17-10-9-16(18)13-15(17)8-7-14-5-3-2-4-6-14/h2-6,9-10,13H,11-12,18H2,1H3 |
| InChIKey | MMIUGFFQCDHFLS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|