C21H26N2O4 — CID 158246343
2-[2-(2-methoxyethoxy)ethoxy]benzene-1,4-diamine;naphthalen-1-ol (PubChem CID 158246343) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethoxy]benzene-1,4-diamine;naphthalen-1-ol.
| Compound Name | 2-[2-(2-methoxyethoxy)ethoxy]benzene-1,4-diamine;naphthalen-1-ol |
|---|---|
| PubChem CID | 158246343 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethoxy]benzene-1,4-diamine;naphthalen-1-ol |
| SMILES | COCCOCCOc1cc(N)ccc1N.Oc1cccc2ccccc12 |
| InChI | InChI=1S/C11H18N2O3.C10H8O/c1-14-4-5-15-6-7-16-11-8-9(12)2-3-10(11)13;11-10-7-3-5-8-4-1-2-6-9(8)10/h2-3,8H,4-7,12-13H2,1H3;1-7,11H |
| InChIKey | GGDUOIOVGRXEML-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|