C17H23ClN2O5 — CID 159595440
4-chlorobenzene-1,3-diol;2-[2-(2-methoxyethoxy)ethoxy]benzene-1,4-diamine (PubChem CID 159595440) has the molecular formula C17H23ClN2O5 and a molecular weight of 370.83 g/mol. Its IUPAC name is 4-chlorobenzene-1,3-diol;2-[2-(2-methoxyethoxy)ethoxy]benzene-1,4-diamine.
| Compound Name | 4-chlorobenzene-1,3-diol;2-[2-(2-methoxyethoxy)ethoxy]benzene-1,4-diamine |
|---|---|
| PubChem CID | 159595440 |
| Molecular Formula | C17H23ClN2O5 |
| Molecular Weight | 370.83 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 4-chlorobenzene-1,3-diol;2-[2-(2-methoxyethoxy)ethoxy]benzene-1,4-diamine |
| SMILES | COCCOCCOc1cc(N)ccc1N.Oc1ccc(Cl)c(O)c1 |
| InChI | InChI=1S/C11H18N2O3.C6H5ClO2/c1-14-4-5-15-6-7-16-11-8-9(12)2-3-10(11)13;7-5-2-1-4(8)3-6(5)9/h2-3,8H,4-7,12-13H2,1H3;1-3,8-9H |
| InChIKey | MKTWRHHMLJNOHQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 120.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.83 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|