C18H28N6O4 — CID 90896274
2-[2-[2-[2,2-diamino-2-(2,5-diaminophenoxy)ethoxy]ethoxy]ethoxy]benzene-1,4-diamine (PubChem CID 90896274) has the molecular formula C18H28N6O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is 2-[2-[2-[2,2-diamino-2-(2,5-diaminophenoxy)ethoxy]ethoxy]ethoxy]benzene-1,4-diamine.
| Compound Name | 2-[2-[2-[2,2-diamino-2-(2,5-diaminophenoxy)ethoxy]ethoxy]ethoxy]benzene-1,4-diamine |
|---|---|
| PubChem CID | 90896274 |
| Molecular Formula | C18H28N6O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 2-[2-[2-[2,2-diamino-2-(2,5-diaminophenoxy)ethoxy]ethoxy]ethoxy]benzene-1,4-diamine |
| SMILES | Nc1ccc(N)c(OCCOCCOCC(N)(N)Oc2cc(N)ccc2N)c1 |
| InChI | InChI=1S/C18H28N6O4/c19-12-1-3-14(21)16(9-12)27-8-7-25-5-6-26-11-18(23,24)28-17-10-13(20)2-4-15(17)22/h1-4,9-10H,5-8,11,19-24H2 |
| InChIKey | GVDMZHHOMPPAEQ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 193.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|