C13H26ClN3O2 — CID 70009436
2-(2,5-diaminophenoxy)ethyl-diethyl-methylazanium;chloride;hydrate (PubChem CID 70009436) has the molecular formula C13H26ClN3O2 and a molecular weight of 291.82 g/mol. Its IUPAC name is 2-(2,5-diaminophenoxy)ethyl-diethyl-methylazanium;chloride;hydrate.
| Compound Name | 2-(2,5-diaminophenoxy)ethyl-diethyl-methylazanium;chloride;hydrate |
|---|---|
| PubChem CID | 70009436 |
| Molecular Formula | C13H26ClN3O2 |
| Molecular Weight | 291.82 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 2-(2,5-diaminophenoxy)ethyl-diethyl-methylazanium;chloride;hydrate |
| SMILES | CC[N+](C)(CC)CCOc1cc(N)ccc1N.O.[Cl-] |
| InChI | InChI=1S/C13H24N3O.ClH.H2O/c1-4-16(3,5-2)8-9-17-13-10-11(14)6-7-12(13)15;;/h6-7,10H,4-5,8-9,14-15H2,1-3H3;1H;1H2/q+1;;/p-1 |
| InChIKey | OBSWVOBABGHYJA-UHFFFAOYSA-M |
| XLogP | -2.10 |
| TPSA | 92.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.82 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|