C14H27Cl3N4O — CID 140675039
2-[2-(4,4-dimethylpiperazin-4-ium-1-yl)ethoxy]benzene-1,4-diamine;chloride;dihydrochloride (PubChem CID 140675039) has the molecular formula C14H27Cl3N4O and a molecular weight of 373.76 g/mol. Its IUPAC name is 2-[2-(4,4-dimethylpiperazin-4-ium-1-yl)ethoxy]benzene-1,4-diamine;chloride;dihydrochloride.
| Compound Name | 2-[2-(4,4-dimethylpiperazin-4-ium-1-yl)ethoxy]benzene-1,4-diamine;chloride;dihydrochloride |
|---|---|
| PubChem CID | 140675039 |
| Molecular Formula | C14H27Cl3N4O |
| Molecular Weight | 373.76 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 2-[2-(4,4-dimethylpiperazin-4-ium-1-yl)ethoxy]benzene-1,4-diamine;chloride;dihydrochloride |
| SMILES | C[N+]1(C)CCN(CCOc2cc(N)ccc2N)CC1.Cl.Cl.[Cl-] |
| InChI | InChI=1S/C14H25N4O.3ClH/c1-18(2)8-5-17(6-9-18)7-10-19-14-11-12(15)3-4-13(14)16;;;/h3-4,11H,5-10,15-16H2,1-2H3;3*1H/q+1;;;/p-1 |
| InChIKey | MLJQLRGMCUWDCT-UHFFFAOYSA-M |
| XLogP | -1.53 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.76 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|