C19H33N4O2+ — CID 121428279
4-[2-[3-(4,4-dimethylpiperazin-4-ium-1-yl)propoxy]ethyl]-2,3-dihydro-1,4-benzoxazin-7-amine (PubChem CID 121428279) has the molecular formula C19H33N4O2+ and a molecular weight of 349.50 g/mol. Its IUPAC name is 4-[2-[3-(4,4-dimethylpiperazin-4-ium-1-yl)propoxy]ethyl]-2,3-dihydro-1,4-benzoxazin-7-amine.
| Compound Name | 4-[2-[3-(4,4-dimethylpiperazin-4-ium-1-yl)propoxy]ethyl]-2,3-dihydro-1,4-benzoxazin-7-amine |
|---|---|
| PubChem CID | 121428279 |
| Molecular Formula | C19H33N4O2+ |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.26 |
| IUPAC Name | 4-[2-[3-(4,4-dimethylpiperazin-4-ium-1-yl)propoxy]ethyl]-2,3-dihydro-1,4-benzoxazin-7-amine |
| SMILES | C[N+]1(C)CCN(CCCOCCN2CCOc3cc(N)ccc32)CC1 |
| InChI | InChI=1S/C19H33N4O2/c1-23(2)11-7-21(8-12-23)6-3-13-24-14-9-22-10-15-25-19-16-17(20)4-5-18(19)22/h4-5,16H,3,6-15,20H2,1-2H3/q+1 |
| InChIKey | XHHLEVJXFZYIAI-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 50.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|