C20H35N4O2+ — CID 121428338
4-[2-[2-[2-(1-methylpiperidin-1-ium-1-yl)ethoxy]ethylamino]ethyl]-2,3-dihydro-1,4-benzoxazin-7-amine (PubChem CID 121428338) has the molecular formula C20H35N4O2+ and a molecular weight of 363.53 g/mol. Its IUPAC name is 4-[2-[2-[2-(1-methylpiperidin-1-ium-1-yl)ethoxy]ethylamino]ethyl]-2,3-dihydro-1,4-benzoxazin-7-amine.
| Compound Name | 4-[2-[2-[2-(1-methylpiperidin-1-ium-1-yl)ethoxy]ethylamino]ethyl]-2,3-dihydro-1,4-benzoxazin-7-amine |
|---|---|
| PubChem CID | 121428338 |
| Molecular Formula | C20H35N4O2+ |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.28 |
| IUPAC Name | 4-[2-[2-[2-(1-methylpiperidin-1-ium-1-yl)ethoxy]ethylamino]ethyl]-2,3-dihydro-1,4-benzoxazin-7-amine |
| SMILES | C[N+]1(CCOCCNCCN2CCOc3cc(N)ccc32)CCCCC1 |
| InChI | InChI=1S/C20H35N4O2/c1-24(11-3-2-4-12-24)13-16-25-14-8-22-7-9-23-10-15-26-20-17-18(21)5-6-19(20)23/h5-6,17,22H,2-4,7-16,21H2,1H3/q+1 |
| InChIKey | KQHARFSQAJKCEW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|