C21H39N5O2 — CID 145102071
N'-[3-[2-[2-(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)ethylamino]ethoxy]propyl]-N'-ethyl-N,N-dimethylethane-1,2-diamine (PubChem CID 145102071) has the molecular formula C21H39N5O2 and a molecular weight of 393.58 g/mol. Its IUPAC name is N'-[3-[2-[2-(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)ethylamino]ethoxy]propyl]-N'-ethyl-N,N-dimethylethane-1,2-diamine.
| Compound Name | N'-[3-[2-[2-(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)ethylamino]ethoxy]propyl]-N'-ethyl-N,N-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 145102071 |
| Molecular Formula | C21H39N5O2 |
| Molecular Weight | 393.58 g/mol |
| Exact Mass | 393.31 |
| IUPAC Name | N'-[3-[2-[2-(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)ethylamino]ethoxy]propyl]-N'-ethyl-N,N-dimethylethane-1,2-diamine |
| SMILES | CCN(CCCOCCNCCN1CCOc2cc(N)ccc21)CCN(C)C |
| InChI | InChI=1S/C21H39N5O2/c1-4-25(13-12-24(2)3)10-5-15-27-16-9-23-8-11-26-14-17-28-21-18-19(22)6-7-20(21)26/h6-7,18,23H,4-5,8-17,22H2,1-3H3 |
| InChIKey | GGCGGIWNHPPTTA-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 66.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.58 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|