C15H27N4O+ — CID 145102076
[(Z)-2-[2-(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)ethyl-methylamino]ethenyl]-methylazanium;methane (PubChem CID 145102076) has the molecular formula C15H27N4O+ and a molecular weight of 279.41 g/mol. Its IUPAC name is [(Z)-2-[2-(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)ethyl-methylamino]ethenyl]-methylazanium;methane.
| Compound Name | [(Z)-2-[2-(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)ethyl-methylamino]ethenyl]-methylazanium;methane |
|---|---|
| PubChem CID | 145102076 |
| Molecular Formula | C15H27N4O+ |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | [(Z)-2-[2-(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)ethyl-methylamino]ethenyl]-methylazanium;methane |
| SMILES | C.C[NH2+]/C=C\N(C)CCN1CCOc2cc(N)ccc21 |
| InChI | InChI=1S/C14H22N4O.CH4/c1-16-5-6-17(2)7-8-18-9-10-19-14-11-12(15)3-4-13(14)18;/h3-6,11,16H,7-10,15H2,1-2H3;1H4/p+1/b6-5-; |
| InChIKey | BHQRLEIXLZJSMC-YSMBQZINSA-O |
| XLogP | 0.70 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|