C19H33N4O+ — CID 121428305
4-[3-[3-(1-methylpyrrolidin-1-ium-1-yl)propylamino]propyl]-2,3-dihydro-1,4-benzoxazin-7-amine (PubChem CID 121428305) has the molecular formula C19H33N4O+ and a molecular weight of 333.50 g/mol. Its IUPAC name is 4-[3-[3-(1-methylpyrrolidin-1-ium-1-yl)propylamino]propyl]-2,3-dihydro-1,4-benzoxazin-7-amine.
| Compound Name | 4-[3-[3-(1-methylpyrrolidin-1-ium-1-yl)propylamino]propyl]-2,3-dihydro-1,4-benzoxazin-7-amine |
|---|---|
| PubChem CID | 121428305 |
| Molecular Formula | C19H33N4O+ |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.26 |
| IUPAC Name | 4-[3-[3-(1-methylpyrrolidin-1-ium-1-yl)propylamino]propyl]-2,3-dihydro-1,4-benzoxazin-7-amine |
| SMILES | C[N+]1(CCCNCCCN2CCOc3cc(N)ccc32)CCCC1 |
| InChI | InChI=1S/C19H33N4O/c1-23(12-2-3-13-23)14-5-9-21-8-4-10-22-11-15-24-19-16-17(20)6-7-18(19)22/h6-7,16,21H,2-5,8-15,20H2,1H3/q+1 |
| InChIKey | BOUQYHFVBOSREL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|