C15H26N4O — CID 118888980
N-[2-(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)ethyl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 118888980) has the molecular formula C15H26N4O and a molecular weight of 278.40 g/mol. Its IUPAC name is N-[2-(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)ethyl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[2-(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)ethyl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 118888980 |
| Molecular Formula | C15H26N4O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | N-[2-(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)ethyl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNCCN1CCOc2cc(N)ccc21 |
| InChI | InChI=1S/C15H26N4O/c1-18(2)8-3-6-17-7-9-19-10-11-20-15-12-13(16)4-5-14(15)19/h4-5,12,17H,3,6-11,16H2,1-2H3 |
| InChIKey | WPZHSNUOVJZKKE-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 53.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|