C14H21N4O+ — CID 145102078
2-(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)ethyl-ethenyl-(methylaminomethylidene)azanium (PubChem CID 145102078) has the molecular formula C14H21N4O+ and a molecular weight of 261.35 g/mol. Its IUPAC name is 2-(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)ethyl-ethenyl-(methylaminomethylidene)azanium.
| Compound Name | 2-(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)ethyl-ethenyl-(methylaminomethylidene)azanium |
|---|---|
| PubChem CID | 145102078 |
| Molecular Formula | C14H21N4O+ |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 2-(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)ethyl-ethenyl-(methylaminomethylidene)azanium |
| SMILES | C=C/[N+](=C\NC)CCN1CCOc2cc(N)ccc21 |
| InChI | InChI=1S/C14H20N4O/c1-3-17(11-16-2)6-7-18-8-9-19-14-10-12(15)4-5-13(14)18/h3-5,10-11H,1,6-9,15H2,2H3/p+1 |
| InChIKey | PPEIZBVVBLVFFH-UHFFFAOYSA-O |
| XLogP | 0.87 |
| TPSA | 53.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|