C20H34N3O2+ — CID 159216543
4-[5-[2-(1-methylpyrrolidin-1-ium-1-yl)ethoxy]pentyl]-2,3-dihydro-1,4-benzoxazin-7-amine (PubChem CID 159216543) has the molecular formula C20H34N3O2+ and a molecular weight of 348.51 g/mol. Its IUPAC name is 4-[5-[2-(1-methylpyrrolidin-1-ium-1-yl)ethoxy]pentyl]-2,3-dihydro-1,4-benzoxazin-7-amine.
| Compound Name | 4-[5-[2-(1-methylpyrrolidin-1-ium-1-yl)ethoxy]pentyl]-2,3-dihydro-1,4-benzoxazin-7-amine |
|---|---|
| PubChem CID | 159216543 |
| Molecular Formula | C20H34N3O2+ |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.26 |
| IUPAC Name | 4-[5-[2-(1-methylpyrrolidin-1-ium-1-yl)ethoxy]pentyl]-2,3-dihydro-1,4-benzoxazin-7-amine |
| SMILES | C[N+]1(CCOCCCCCN2CCOc3cc(N)ccc32)CCCC1 |
| InChI | InChI=1S/C20H34N3O2/c1-23(11-4-5-12-23)13-16-24-14-6-2-3-9-22-10-15-25-20-17-18(21)7-8-19(20)22/h7-8,17H,2-6,9-16,21H2,1H3/q+1 |
| InChIKey | BTAXCUYPKYRPME-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|