C15H26N4O7S — CID 118107831
3-[2-(4,4-dimethylpiperazin-4-ium-1-yl)ethoxy]-4-nitroaniline;methyl sulfate (PubChem CID 118107831) has the molecular formula C15H26N4O7S and a molecular weight of 406.46 g/mol. Its IUPAC name is 3-[2-(4,4-dimethylpiperazin-4-ium-1-yl)ethoxy]-4-nitroaniline;methyl sulfate.
| Compound Name | 3-[2-(4,4-dimethylpiperazin-4-ium-1-yl)ethoxy]-4-nitroaniline;methyl sulfate |
|---|---|
| PubChem CID | 118107831 |
| Molecular Formula | C15H26N4O7S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 3-[2-(4,4-dimethylpiperazin-4-ium-1-yl)ethoxy]-4-nitroaniline;methyl sulfate |
| SMILES | COS(=O)(=O)[O-].C[N+]1(C)CCN(CCOc2cc(N)ccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C14H23N4O3.CH4O4S/c1-18(2)8-5-16(6-9-18)7-10-21-14-11-12(15)3-4-13(14)17(19)20;1-5-6(2,3)4/h3-4,11H,5-10,15H2,1-2H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | IJFBWZJEUBLGHL-UHFFFAOYSA-M |
| XLogP | 0.04 |
| TPSA | 148.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|