C16H27N2O3+ — CID 20778759
2-[4-amino-2-(2-hydroxyethyl)benzoyl]oxyethyl-diethyl-methylazanium (PubChem CID 20778759) has the molecular formula C16H27N2O3+ and a molecular weight of 295.40 g/mol. Its IUPAC name is 2-[4-amino-2-(2-hydroxyethyl)benzoyl]oxyethyl-diethyl-methylazanium.
| Compound Name | 2-[4-amino-2-(2-hydroxyethyl)benzoyl]oxyethyl-diethyl-methylazanium |
|---|---|
| PubChem CID | 20778759 |
| Molecular Formula | C16H27N2O3+ |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | 2-[4-amino-2-(2-hydroxyethyl)benzoyl]oxyethyl-diethyl-methylazanium |
| SMILES | CC[N+](C)(CC)CCOC(=O)c1ccc(N)cc1CCO |
| InChI | InChI=1S/C16H26N2O3/c1-4-18(3,5-2)9-11-21-16(20)15-7-6-14(17)12-13(15)8-10-19/h6-7,12,19H,4-5,8-11H2,1-3H3,(H-,17,20)/p+1 |
| InChIKey | YHSKUJXCAFEIJF-UHFFFAOYSA-O |
| XLogP | 1.45 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|