C13H21IN2O3 — CID 18417813
2-(4-amino-2-hydroxybenzoyl)oxyethyl-ethyl-dimethylazanium iodide (PubChem CID 18417813) has the molecular formula C13H21IN2O3 and a molecular weight of 380.23 g/mol. Its IUPAC name is 2-(4-amino-2-hydroxybenzoyl)oxyethyl-ethyl-dimethylazanium iodide.
| Compound Name | 2-(4-amino-2-hydroxybenzoyl)oxyethyl-ethyl-dimethylazanium iodide |
|---|---|
| PubChem CID | 18417813 |
| Molecular Formula | C13H21IN2O3 |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 2-(4-amino-2-hydroxybenzoyl)oxyethyl-ethyl-dimethylazanium iodide |
| SMILES | CC[N+](C)(C)CCOC(=O)c1ccc(N)cc1O.[I-] |
| InChI | InChI=1S/C13H20N2O3.HI/c1-4-15(2,3)7-8-18-13(17)11-6-5-10(14)9-12(11)16;/h5-6,9H,4,7-8H2,1-3H3,(H2-,14,16,17);1H |
| InChIKey | DPELRYAMBWNPNK-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|