C12H19ClN2O3 — CID 18466334
2-(4-amino-2-hydroxybenzoyl)oxyethyl-trimethylazanium chloride (PubChem CID 18466334) has the molecular formula C12H19ClN2O3 and a molecular weight of 274.75 g/mol. Its IUPAC name is 2-(4-amino-2-hydroxybenzoyl)oxyethyl-trimethylazanium chloride.
| Compound Name | 2-(4-amino-2-hydroxybenzoyl)oxyethyl-trimethylazanium chloride |
|---|---|
| PubChem CID | 18466334 |
| Molecular Formula | C12H19ClN2O3 |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 2-(4-amino-2-hydroxybenzoyl)oxyethyl-trimethylazanium chloride |
| SMILES | C[N+](C)(C)CCOC(=O)c1ccc(N)cc1O.[Cl-] |
| InChI | InChI=1S/C12H18N2O3.ClH/c1-14(2,3)6-7-17-12(16)10-5-4-9(13)8-11(10)15;/h4-5,8H,6-7H2,1-3H3,(H2-,13,15,16);1H |
| InChIKey | XFYINZNBSIZGFU-UHFFFAOYSA-N |
| XLogP | -2.16 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|