C18H36O5 — CID 141036913
10,10,12-trihydroxyoctadecanoic acid (PubChem CID 141036913) has the molecular formula C18H36O5 and a molecular weight of 332.48 g/mol. Its IUPAC name is 10,10,12-trihydroxyoctadecanoic acid.
| Compound Name | 10,10,12-trihydroxyoctadecanoic acid |
|---|---|
| PubChem CID | 141036913 |
| Molecular Formula | C18H36O5 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.26 |
| IUPAC Name | 10,10,12-trihydroxyoctadecanoic acid |
| SMILES | CCCCCCC(O)CC(O)(O)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H36O5/c1-2-3-4-9-12-16(19)15-18(22,23)14-11-8-6-5-7-10-13-17(20)21/h16,19,22-23H,2-15H2,1H3,(H,20,21) |
| InChIKey | BMSNQWIKIOWSBR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|