C10H23NO3 — CID 141037486
azanium 3,4-diethyl-4-hydroxyhexanoate (PubChem CID 141037486) has the molecular formula C10H23NO3 and a molecular weight of 205.30 g/mol. Its IUPAC name is azanium 3,4-diethyl-4-hydroxyhexanoate.
| Compound Name | azanium 3,4-diethyl-4-hydroxyhexanoate |
|---|---|
| PubChem CID | 141037486 |
| Molecular Formula | C10H23NO3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.17 |
| IUPAC Name | azanium 3,4-diethyl-4-hydroxyhexanoate |
| SMILES | CCC(CC(=O)[O-])C(O)(CC)CC.[NH4+] |
| InChI | InChI=1S/C10H20O3.H3N/c1-4-8(7-9(11)12)10(13,5-2)6-3;/h8,13H,4-7H2,1-3H3,(H,11,12);1H3 |
| InChIKey | VAODOKFVNVURSE-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |