About [fluoro(hexoxy)phosphoryl]oxy-triphenyl-λ4-sulfane
[fluoro(hexoxy)phosphoryl]oxy-triphenyl-λ4-sulfane (PubChem CID 141038508) has the molecular formula C24H28FO3PS
and a molecular weight of 446.52 g/mol. Its IUPAC name is [fluoro(hexoxy)phosphoryl]oxy-triphenyl-λ4-sulfane.
Molecular Properties
| Compound Name | [fluoro(hexoxy)phosphoryl]oxy-triphenyl-λ4-sulfane |
| PubChem CID | 141038508 |
| Molecular Formula | C24H28FO3PS |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | [fluoro(hexoxy)phosphoryl]oxy-triphenyl-λ4-sulfane |
| SMILES | CCCCCCOP(=O)(F)OS(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H28FO3PS/c1-2-3-4-14-21-27-29(25,26)28-30(22-15-8-5-9-16-22,23-17-10-6-11-18-23)24-19-12-7-13-20-24/h5-13,15-20H,2-4,14,21H2,1H3 |
| InChIKey | XZGOLFRJQQVROZ-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [fluoro(hexoxy)phosphoryl]oxy-triphenyl-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [fluoro(hexoxy)phosphoryl]oxy-triphenyl-λ4-sulfane?
The IUPAC name of [fluoro(hexoxy)phosphoryl]oxy-triphenyl-λ4-sulfane (CID 141038508) is [fluoro(hexoxy)phosphoryl]oxy-triphenyl-λ4-sulfane.
What is the SMILES notation for [fluoro(hexoxy)phosphoryl]oxy-triphenyl-λ4-sulfane?
The canonical SMILES for [fluoro(hexoxy)phosphoryl]oxy-triphenyl-λ4-sulfane is CCCCCCOP(=O)(F)OS(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of [fluoro(hexoxy)phosphoryl]oxy-triphenyl-λ4-sulfane?
The InChIKey is XZGOLFRJQQVROZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28FO3PS/c1-2-3-4-14-21-27-29(25,26)28-30(22-15-8-5-9-16-22,23-17-10-6-11-18-23)24-19-12-7-13-20-24/h5-13,15-20H,2-4,14,21H2,1H3.
What are the key properties of [fluoro(hexoxy)phosphoryl]oxy-triphenyl-λ4-sulfane?
[fluoro(hexoxy)phosphoryl]oxy-triphenyl-λ4-sulfane has a molecular weight of 446.52 g/mol, XLogP of 8.57, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [fluoro(hexoxy)phosphoryl]oxy-triphenyl-λ4-sulfane is sourced from PubChem (CID 141038508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).