C22H30O4P2S — CID 163886353
tert-butyl-diphenyl-(6-phosphoroso-6-phosphorosooxyhexoxy)-λ4-sulfane (PubChem CID 163886353) has the molecular formula C22H30O4P2S and a molecular weight of 452.49 g/mol. Its IUPAC name is tert-butyl-diphenyl-(6-phosphoroso-6-phosphorosooxyhexoxy)-λ4-sulfane.
| Compound Name | tert-butyl-diphenyl-(6-phosphoroso-6-phosphorosooxyhexoxy)-λ4-sulfane |
|---|---|
| PubChem CID | 163886353 |
| Molecular Formula | C22H30O4P2S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | tert-butyl-diphenyl-(6-phosphoroso-6-phosphorosooxyhexoxy)-λ4-sulfane |
| SMILES | CC(C)(C)S(OCCCCCC(OP=O)P=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H30O4P2S/c1-22(2,3)29(19-13-7-4-8-14-19,20-15-9-5-10-16-20)25-18-12-6-11-17-21(27-23)26-28-24/h4-5,7-10,13-16,21H,6,11-12,17-18H2,1-3H3 |
| InChIKey | PXQSRGZQRIDALN-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|