C19H22O3 — CID 141040292
6-pentyl-15-oxatetracyclo[8.5.0.01,14.03,8]pentadeca-3(8),10,12-triene-2,9-dione (PubChem CID 141040292) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is 6-pentyl-15-oxatetracyclo[8.5.0.01,14.03,8]pentadeca-3(8),10,12-triene-2,9-dione.
| Compound Name | 6-pentyl-15-oxatetracyclo[8.5.0.01,14.03,8]pentadeca-3(8),10,12-triene-2,9-dione |
|---|---|
| PubChem CID | 141040292 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 6-pentyl-15-oxatetracyclo[8.5.0.01,14.03,8]pentadeca-3(8),10,12-triene-2,9-dione |
| SMILES | CCCCCC1CCC2=C(C1)C(=O)C1=CC=CC3OC13C2=O |
| InChI | InChI=1S/C19H22O3/c1-2-3-4-6-12-9-10-13-14(11-12)17(20)15-7-5-8-16-19(15,22-16)18(13)21/h5,7-8,12,16H,2-4,6,9-11H2,1H3 |
| InChIKey | RAKQXEZADXAHGW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|