C14H12O3 — CID 141437524
15-oxatetracyclo[8.5.0.01,14.03,8]pentadeca-3(8),10,12-triene-2,9-dione (PubChem CID 141437524) has the molecular formula C14H12O3 and a molecular weight of 228.25 g/mol. Its IUPAC name is 15-oxatetracyclo[8.5.0.01,14.03,8]pentadeca-3(8),10,12-triene-2,9-dione.
| Compound Name | 15-oxatetracyclo[8.5.0.01,14.03,8]pentadeca-3(8),10,12-triene-2,9-dione |
|---|---|
| PubChem CID | 141437524 |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 15-oxatetracyclo[8.5.0.01,14.03,8]pentadeca-3(8),10,12-triene-2,9-dione |
| SMILES | O=C1C2=CC=CC3OC23C(=O)C2=C1CCCC2 |
| InChI | InChI=1S/C14H12O3/c15-12-8-4-1-2-5-9(8)13(16)14-10(12)6-3-7-11(14)17-14/h3,6-7,11H,1-2,4-5H2 |
| InChIKey | WTCJFDZVCSBOIM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|