C11H12O2 — CID 11355803
spiro[5,6,7,8-tetrahydronaphthalene-2,2'-oxirane]-1-one (PubChem CID 11355803) has the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. Its IUPAC name is spiro[5,6,7,8-tetrahydronaphthalene-2,2'-oxirane]-1-one.
| Compound Name | spiro[5,6,7,8-tetrahydronaphthalene-2,2'-oxirane]-1-one |
|---|---|
| PubChem CID | 11355803 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | spiro[5,6,7,8-tetrahydronaphthalene-2,2'-oxirane]-1-one |
| SMILES | O=C1C2=C(C=CC13CO3)CCCC2 |
| InChI | InChI=1S/C11H12O2/c12-10-9-4-2-1-3-8(9)5-6-11(10)7-13-11/h5-6H,1-4,7H2 |
| InChIKey | RTAVLZVJDHNVJN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|