C11H12O2 — CID 102591824
5-but-3-enyl-1-oxaspiro[2.5]octa-5,7-dien-4-one (PubChem CID 102591824) has the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. Its IUPAC name is 5-but-3-enyl-1-oxaspiro[2.5]octa-5,7-dien-4-one.
| Compound Name | 5-but-3-enyl-1-oxaspiro[2.5]octa-5,7-dien-4-one |
|---|---|
| PubChem CID | 102591824 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 5-but-3-enyl-1-oxaspiro[2.5]octa-5,7-dien-4-one |
| SMILES | C=CCCC1=CC=CC2(CO2)C1=O |
| InChI | InChI=1S/C11H12O2/c1-2-3-5-9-6-4-7-11(8-13-11)10(9)12/h2,4,6-7H,1,3,5,8H2 |
| InChIKey | KVCGLDGTFINXFV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|