C10H10O2 — CID 24752228
spiro[2,3-dihydro-1H-indene-4,2'-oxirane]-5-one (PubChem CID 24752228) has the molecular formula C10H10O2 and a molecular weight of 162.19 g/mol. Its IUPAC name is spiro[2,3-dihydro-1H-indene-4,2'-oxirane]-5-one.
| Compound Name | spiro[2,3-dihydro-1H-indene-4,2'-oxirane]-5-one |
|---|---|
| PubChem CID | 24752228 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | spiro[2,3-dihydro-1H-indene-4,2'-oxirane]-5-one |
| SMILES | O=C1C=CC2=C(CCC2)C12CO2 |
| InChI | InChI=1S/C10H10O2/c11-9-5-4-7-2-1-3-8(7)10(9)6-12-10/h4-5H,1-3,6H2 |
| InChIKey | LOSULYBMFZDYRN-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|