C11H12O2 — CID 24752658
6-methylspiro[2,3-dihydro-1H-indene-4,2'-oxirane]-5-one (PubChem CID 24752658) has the molecular formula C11H12O2 and a molecular weight of 176.22 g/mol. Its IUPAC name is 6-methylspiro[2,3-dihydro-1H-indene-4,2'-oxirane]-5-one.
| Compound Name | 6-methylspiro[2,3-dihydro-1H-indene-4,2'-oxirane]-5-one |
|---|---|
| PubChem CID | 24752658 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 6-methylspiro[2,3-dihydro-1H-indene-4,2'-oxirane]-5-one |
| SMILES | CC1=CC2=C(CCC2)C2(CO2)C1=O |
| InChI | InChI=1S/C11H12O2/c1-7-5-8-3-2-4-9(8)11(6-13-11)10(7)12/h5H,2-4,6H2,1H3 |
| InChIKey | FNWKJXLSZOZBDP-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|