About 6-bromospiro[2,3-dihydro-1H-indene-4,2'-oxirane]-5-one
6-bromospiro[2,3-dihydro-1H-indene-4,2'-oxirane]-5-one (PubChem CID 24752657) has the molecular formula C10H9BrO2
and a molecular weight of 241.08 g/mol. Its IUPAC name is 6-bromospiro[2,3-dihydro-1H-indene-4,2'-oxirane]-5-one.
Molecular Properties
| Compound Name | 6-bromospiro[2,3-dihydro-1H-indene-4,2'-oxirane]-5-one |
| PubChem CID | 24752657 |
| Molecular Formula | C10H9BrO2 |
| Molecular Weight | 241.08 g/mol |
| Exact Mass | 239.98 |
| IUPAC Name | 6-bromospiro[2,3-dihydro-1H-indene-4,2'-oxirane]-5-one |
| SMILES | O=C1C(Br)=CC2=C(CCC2)C12CO2 |
| InChI | InChI=1S/C10H9BrO2/c11-8-4-6-2-1-3-7(6)10(5-13-10)9(8)12/h4H,1-3,5H2 |
| InChIKey | AFVMJKYXHSOCEJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.08 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 6-bromospiro[2,3-dihydro-1H-indene-4,2'-oxirane]-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromospiro[2,3-dihydro-1H-indene-4,2'-oxirane]-5-one?
The IUPAC name of 6-bromospiro[2,3-dihydro-1H-indene-4,2'-oxirane]-5-one (CID 24752657) is 6-bromospiro[2,3-dihydro-1H-indene-4,2'-oxirane]-5-one.
What is the SMILES notation for 6-bromospiro[2,3-dihydro-1H-indene-4,2'-oxirane]-5-one?
The canonical SMILES for 6-bromospiro[2,3-dihydro-1H-indene-4,2'-oxirane]-5-one is O=C1C(Br)=CC2=C(CCC2)C12CO2.
What is the InChIKey of 6-bromospiro[2,3-dihydro-1H-indene-4,2'-oxirane]-5-one?
The InChIKey is AFVMJKYXHSOCEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrO2/c11-8-4-6-2-1-3-7(6)10(5-13-10)9(8)12/h4H,1-3,5H2.
What are the key properties of 6-bromospiro[2,3-dihydro-1H-indene-4,2'-oxirane]-5-one?
6-bromospiro[2,3-dihydro-1H-indene-4,2'-oxirane]-5-one has a molecular weight of 241.08 g/mol, XLogP of 2.10, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromospiro[2,3-dihydro-1H-indene-4,2'-oxirane]-5-one is sourced from PubChem (CID 24752657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).