C10H10N2OS — CID 141040351
2-(2H-1,3-thiazol-3-yliminomethyl)phenol (PubChem CID 141040351) has the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. Its IUPAC name is 2-(2H-1,3-thiazol-3-yliminomethyl)phenol.
| Compound Name | 2-(2H-1,3-thiazol-3-yliminomethyl)phenol |
|---|---|
| PubChem CID | 141040351 |
| Molecular Formula | C10H10N2OS |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 2-(2H-1,3-thiazol-3-yliminomethyl)phenol |
| SMILES | Oc1ccccc1C=NN1C=CSC1 |
| InChI | InChI=1S/C10H10N2OS/c13-10-4-2-1-3-9(10)7-11-12-5-6-14-8-12/h1-7,13H,8H2 |
| InChIKey | QLLVXDLQQWRWAM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|