About N-sulfanylcarbamoyl bromide
N-sulfanylcarbamoyl bromide (PubChem CID 141041734) has the molecular formula CH2BrNOS
and a molecular weight of 156.00 g/mol. Its IUPAC name is N-sulfanylcarbamoyl bromide.
Molecular Properties
| Compound Name | N-sulfanylcarbamoyl bromide |
| PubChem CID | 141041734 |
| Molecular Formula | CH2BrNOS |
| Molecular Weight | 156.00 g/mol |
| Exact Mass | 154.90 |
| IUPAC Name | N-sulfanylcarbamoyl bromide |
| SMILES | O=C(Br)NS |
| InChI | InChI=1S/CH2BrNOS/c2-1(4)3-5/h5H,(H,3,4) |
| InChIKey | IINFLBKBCKNRNT-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.00 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-sulfanylcarbamoyl bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-sulfanylcarbamoyl bromide?
The IUPAC name of N-sulfanylcarbamoyl bromide (CID 141041734) is N-sulfanylcarbamoyl bromide.
What is the SMILES notation for N-sulfanylcarbamoyl bromide?
The canonical SMILES for N-sulfanylcarbamoyl bromide is O=C(Br)NS.
What is the InChIKey of N-sulfanylcarbamoyl bromide?
The InChIKey is IINFLBKBCKNRNT-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2BrNOS/c2-1(4)3-5/h5H,(H,3,4).
What are the key properties of N-sulfanylcarbamoyl bromide?
N-sulfanylcarbamoyl bromide has a molecular weight of 156.00 g/mol, XLogP of 0.94, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-sulfanylcarbamoyl bromide is sourced from PubChem (CID 141041734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).