C4H10N2O3S2 — CID 175121420
N,N'-bis(sulfanyl)oxamide;ethanol (PubChem CID 175121420) has the molecular formula C4H10N2O3S2 and a molecular weight of 198.27 g/mol. Its IUPAC name is N,N'-bis(sulfanyl)oxamide;ethanol.
| Compound Name | N,N'-bis(sulfanyl)oxamide;ethanol |
|---|---|
| PubChem CID | 175121420 |
| Molecular Formula | C4H10N2O3S2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.01 |
| IUPAC Name | N,N'-bis(sulfanyl)oxamide;ethanol |
| SMILES | CCO.O=C(NS)C(=O)NS |
| InChI | InChI=1S/C2H4N2O2S2.C2H6O/c5-1(3-7)2(6)4-8;1-2-3/h7-8H,(H,3,5)(H,4,6);3H,2H2,1H3 |
| InChIKey | DWDNOPOZHUNGFT-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|