C16H30O5 — CID 141041790
1,1,1-tri(propan-2-yloxy)heptane-2,3-dione (PubChem CID 141041790) has the molecular formula C16H30O5 and a molecular weight of 302.41 g/mol. Its IUPAC name is 1,1,1-tri(propan-2-yloxy)heptane-2,3-dione.
| Compound Name | 1,1,1-tri(propan-2-yloxy)heptane-2,3-dione |
|---|---|
| PubChem CID | 141041790 |
| Molecular Formula | C16H30O5 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 1,1,1-tri(propan-2-yloxy)heptane-2,3-dione |
| SMILES | CCCCC(=O)C(=O)C(OC(C)C)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C16H30O5/c1-8-9-10-14(17)15(18)16(19-11(2)3,20-12(4)5)21-13(6)7/h11-13H,8-10H2,1-7H3 |
| InChIKey | GJSFWMKUEAGZIH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|